ChemNet > CAS > 69625-13-4 2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetonitrile
69625-13-4 2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetonitrile
název výrobku |
2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetonitrile |
Synonyma |
[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetonitrile |
Molekulární vzorec |
C11H7N3O2S |
Molekulová hmotnost |
245.2572 |
InChI |
InChI=1/C11H7N3O2S/c12-6-5-11-13-10(7-17-11)8-1-3-9(4-2-8)14(15)16/h1-4,7H,5H2 |
Registrační číslo CAS |
69625-13-4 |
Molekulární struktura |
|
Hustota |
1.397g/cm3 |
Bod tání |
147℃ |
Bod varu |
457.3°C at 760 mmHg |
Index lomu |
1.641 |
Bod vzplanutí |
230.3°C |
Symbolů nebezpečnosti |
Xn:Harmful;
|
Riziko Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Bezpečnostní Popis |
S36/37:Wear suitable protective clothing and gloves.;
|
|